C23H27FN4O4 — CID 118112043
4-fluoro-3-[[6-methoxy-7-[2-(oxolan-2-ylmethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol (PubChem CID 118112043) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-fluoro-3-[[6-methoxy-7-[2-(oxolan-2-ylmethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol.
| Compound Name | 4-fluoro-3-[[6-methoxy-7-[2-(oxolan-2-ylmethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 118112043 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-fluoro-3-[[6-methoxy-7-[2-(oxolan-2-ylmethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol |
| SMILES | COc1cc2c(Nc3c(F)ccc(O)c3C)ncnc2cc1OCCNCC1CCCO1 |
| InChI | InChI=1S/C23H27FN4O4/c1-14-19(29)6-5-17(24)22(14)28-23-16-10-20(30-2)21(11-18(16)26-13-27-23)32-9-7-25-12-15-4-3-8-31-15/h5-6,10-11,13,15,25,29H,3-4,7-9,12H2,1-2H3,(H,26,27,28) |
| InChIKey | NXGYYJCJBADRDH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|