C19H18ClFN4O2 — CID 66936744
4-N-(3-chloro-4-fluorophenyl)-7-[[(2S)-oxolan-2-yl]methoxy]quinazoline-4,6-diamine (PubChem CID 66936744) has the molecular formula C19H18ClFN4O2 and a molecular weight of 388.83 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-7-[[(2S)-oxolan-2-yl]methoxy]quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-7-[[(2S)-oxolan-2-yl]methoxy]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 66936744 |
| Molecular Formula | C19H18ClFN4O2 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-7-[[(2S)-oxolan-2-yl]methoxy]quinazoline-4,6-diamine |
| SMILES | Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H18ClFN4O2/c20-14-6-11(3-4-15(14)21)25-19-13-7-16(22)18(8-17(13)23-10-24-19)27-9-12-2-1-5-26-12/h3-4,6-8,10,12H,1-2,5,9,22H2,(H,23,24,25)/t12-/m0/s1 |
| InChIKey | NMYUQRVTMBHNKE-LBPRGKRZSA-N |
| XLogP | 4.31 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|