C22H23ClFN5O — CID 126689897
4-N-(3-chloro-4-fluorophenyl)-7-[2-[(5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]quinazoline-4,6-diamine (PubChem CID 126689897) has the molecular formula C22H23ClFN5O and a molecular weight of 427.91 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-7-[2-[(5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-7-[2-[(5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 126689897 |
| Molecular Formula | C22H23ClFN5O |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-7-[2-[(5R)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]quinazoline-4,6-diamine |
| SMILES | CN1CC2C(CCOc3cc4ncnc(Nc5ccc(F)c(Cl)c5)c4cc3N)[C@H]2C1 |
| InChI | InChI=1S/C22H23ClFN5O/c1-29-9-15-13(16(15)10-29)4-5-30-21-8-20-14(7-19(21)25)22(27-11-26-20)28-12-2-3-18(24)17(23)6-12/h2-3,6-8,11,13,15-16H,4-5,9-10,25H2,1H3,(H,26,27,28)/t13?,15-,16?/m1/s1 |
| InChIKey | YVAPTVDVSHUDFF-OGVSOVDVSA-N |
| XLogP | 4.32 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|