C18H18ClFN4O2 — CID 118900258
4-N-(3-chloro-4-fluorophenyl)-7-(3-methoxypropoxy)quinazoline-4,6-diamine (PubChem CID 118900258) has the molecular formula C18H18ClFN4O2 and a molecular weight of 376.82 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-7-(3-methoxypropoxy)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-7-(3-methoxypropoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 118900258 |
| Molecular Formula | C18H18ClFN4O2 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-7-(3-methoxypropoxy)quinazoline-4,6-diamine |
| SMILES | COCCCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1N |
| InChI | InChI=1S/C18H18ClFN4O2/c1-25-5-2-6-26-17-9-16-12(8-15(17)21)18(23-10-22-16)24-11-3-4-14(20)13(19)7-11/h3-4,7-10H,2,5-6,21H2,1H3,(H,22,23,24) |
| InChIKey | PNHSDTZEYGMHNA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|