C25H31Cl2N5O3 — CID 142852402
7-[[4-(5-aminopentyl)morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 142852402) has the molecular formula C25H31Cl2N5O3 and a molecular weight of 520.46 g/mol. Its IUPAC name is 7-[[4-(5-aminopentyl)morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[4-(5-aminopentyl)morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 142852402 |
| Molecular Formula | C25H31Cl2N5O3 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 7-[[4-(5-aminopentyl)morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCC1CN(CCCCCN)CCO1 |
| InChI | InChI=1S/C25H31Cl2N5O3/c1-33-23-12-19-22(29-16-30-25(19)31-17-5-6-20(26)21(27)11-17)13-24(23)35-15-18-14-32(9-10-34-18)8-4-2-3-7-28/h5-6,11-13,16,18H,2-4,7-10,14-15,28H2,1H3,(H,29,30,31) |
| InChIKey | MARSETAOFXZTEP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|