C22H22Cl2N6O3 — CID 71085596
7-[[3-(4-aminobutyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 71085596) has the molecular formula C22H22Cl2N6O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is 7-[[3-(4-aminobutyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[3-(4-aminobutyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 71085596 |
| Molecular Formula | C22H22Cl2N6O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 7-[[3-(4-aminobutyl)-1,2,4-oxadiazol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCc1nc(CCCCN)no1 |
| InChI | InChI=1S/C22H22Cl2N6O3/c1-31-18-9-14-17(26-12-27-22(14)28-13-5-6-15(23)16(24)8-13)10-19(18)32-11-21-29-20(30-33-21)4-2-3-7-25/h5-6,8-10,12H,2-4,7,11,25H2,1H3,(H,26,27,28) |
| InChIKey | RMOSMVIGXXMVPF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|