C22H20Cl2N5O2S2- — CID 142852286
2-[4-[[4-(3,4-dichloroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1,3-thiazol-2-yl]ethylsulfanylmethylazanide (PubChem CID 142852286) has the molecular formula C22H20Cl2N5O2S2- and a molecular weight of 521.48 g/mol. Its IUPAC name is 2-[4-[[4-(3,4-dichloroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1,3-thiazol-2-yl]ethylsulfanylmethylazanide.
| Compound Name | 2-[4-[[4-(3,4-dichloroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1,3-thiazol-2-yl]ethylsulfanylmethylazanide |
|---|---|
| PubChem CID | 142852286 |
| Molecular Formula | C22H20Cl2N5O2S2- |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | 2-[4-[[4-(3,4-dichloroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1,3-thiazol-2-yl]ethylsulfanylmethylazanide |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCc1csc(CCSC[NH-])n1 |
| InChI | InChI=1S/C22H20Cl2N5O2S2/c1-30-19-7-15-18(26-12-27-22(15)29-13-2-3-16(23)17(24)6-13)8-20(19)31-9-14-10-33-21(28-14)4-5-32-11-25/h2-3,6-8,10,12,25H,4-5,9,11H2,1H3,(H,26,27,29)/q-1 |
| InChIKey | AFALYMSPUANPSH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|