C24H31Cl2N4O5S+ — CID 163591195
CID 163591195 (PubChem CID 163591195) has the molecular formula C24H31Cl2N4O5S+ and a molecular weight of 558.51 g/mol.
| Compound Name | CID 163591195 |
|---|---|
| PubChem CID | 163591195 |
| Molecular Formula | C24H31Cl2N4O5S+ |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | — |
| SMILES | CCCC[S+](=O)(O)N1CCOC(COc2cc3c(cc2OC)c(Nc2ccc(Cl)c(Cl)c2)nn3C)C1 |
| InChI | InChI=1S/C24H30Cl2N4O5S/c1-4-5-10-36(31,32)30-8-9-34-17(14-30)15-35-23-13-21-18(12-22(23)33-3)24(28-29(21)2)27-16-6-7-19(25)20(26)11-16/h6-7,11-13,17H,4-5,8-10,14-15H2,1-3H3,(H-,27,28,31,32)/p+1 |
| InChIKey | CESMWTSZULZTED-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|