C23H24Cl3FN4O3 — CID 66838545
7-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]-N-(3,4-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride (PubChem CID 66838545) has the molecular formula C23H24Cl3FN4O3 and a molecular weight of 529.83 g/mol. Its IUPAC name is 7-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]-N-(3,4-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride.
| Compound Name | 7-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]-N-(3,4-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 66838545 |
| Molecular Formula | C23H24Cl3FN4O3 |
| Molecular Weight | 529.83 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 7-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methoxy]-N-(3,4-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1OC[C@@H]1CN2CCC[C@H]2CO1.Cl |
| InChI | InChI=1S/C23H23Cl2FN4O3.ClH/c1-31-19-7-15-18(8-20(19)33-11-14-9-30-6-2-3-13(30)10-32-14)27-12-28-23(15)29-17-5-4-16(24)21(25)22(17)26;/h4-5,7-8,12-14H,2-3,6,9-11H2,1H3,(H,27,28,29);1H/t13-,14-;/m0./s1 |
| InChIKey | YVDKJGMUVLJFGE-IODNYQNNSA-N |
| XLogP | 5.49 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|