C23H24BrCl2FN4O4 — CID 66838629
7-[[(3S,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride (PubChem CID 66838629) has the molecular formula C23H24BrCl2FN4O4 and a molecular weight of 590.28 g/mol. Its IUPAC name is 7-[[(3S,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride.
| Compound Name | 7-[[(3S,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 66838629 |
| Molecular Formula | C23H24BrCl2FN4O4 |
| Molecular Weight | 590.28 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | 7-[[(3S,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2c(Nc3cc(Cl)c(Br)cc3F)ncnc2cc1OC[C@@H]1CN2CCOC[C@H]2CO1.Cl |
| InChI | InChI=1S/C23H23BrClFN4O4.ClH/c1-31-21-4-15-19(27-12-28-23(15)29-20-6-17(25)16(24)5-18(20)26)7-22(21)34-11-14-8-30-2-3-32-9-13(30)10-33-14;/h4-7,12-14H,2-3,8-11H2,1H3,(H,27,28,29);1H/t13-,14-;/m0./s1 |
| InChIKey | APWYSPVCYMUNOW-IODNYQNNSA-N |
| XLogP | 4.84 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|