C27H31BrClFN4O2 — CID 10393395
7-[[(3aS,6aR)-2-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 10393395) has the molecular formula C27H31BrClFN4O2 and a molecular weight of 577.93 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-2-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3aS,6aR)-2-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 10393395 |
| Molecular Formula | C27H31BrClFN4O2 |
| Molecular Weight | 577.93 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 7-[[(3aS,6aR)-2-(2-methylpropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)c(Cl)c3F)ncnc2cc1OCC1C[C@@H]2CN(CC(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C27H31BrClFN4O2/c1-15(2)10-34-11-17-6-16(7-18(17)12-34)13-36-24-9-22-19(8-23(24)35-3)27(32-14-31-22)33-21-5-4-20(28)25(29)26(21)30/h4-5,8-9,14-18H,6-7,10-13H2,1-3H3,(H,31,32,33)/t16?,17-,18+ |
| InChIKey | WQHZIFFISAIJEF-AYHJJNSGSA-N |
| XLogP | 6.93 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.93 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|