C24H25BrClFN4O2 — CID 70801324
7-[[(3aR,6aS)-2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-4-(4-bromo-3-chloro-2-fluoroanilino)quinazolin-6-ol (PubChem CID 70801324) has the molecular formula C24H25BrClFN4O2 and a molecular weight of 535.85 g/mol. Its IUPAC name is 7-[[(3aR,6aS)-2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-4-(4-bromo-3-chloro-2-fluoroanilino)quinazolin-6-ol.
| Compound Name | 7-[[(3aR,6aS)-2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-4-(4-bromo-3-chloro-2-fluoroanilino)quinazolin-6-ol |
|---|---|
| PubChem CID | 70801324 |
| Molecular Formula | C24H25BrClFN4O2 |
| Molecular Weight | 535.85 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 7-[[(3aR,6aS)-2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-4-(4-bromo-3-chloro-2-fluoroanilino)quinazolin-6-ol |
| SMILES | CCN1C[C@H]2CC(COc3cc4ncnc(Nc5ccc(Br)c(Cl)c5F)c4cc3O)C[C@H]2C1 |
| InChI | InChI=1S/C24H25BrClFN4O2/c1-2-31-9-14-5-13(6-15(14)10-31)11-33-21-8-19-16(7-20(21)32)24(29-12-28-19)30-18-4-3-17(25)22(26)23(18)27/h3-4,7-8,12-15,32H,2,5-6,9-11H2,1H3,(H,28,29,30)/t13?,14-,15+ |
| InChIKey | WQLNMUYUQMQAJQ-GOOCMWNKSA-N |
| XLogP | 5.99 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.85 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|