C28H31Cl2FN4O4 — CID 66838674
(3aS,6aR)-3-tert-butyl-5-[[4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 66838674) has the molecular formula C28H31Cl2FN4O4 and a molecular weight of 577.48 g/mol. Its IUPAC name is (3aS,6aR)-3-tert-butyl-5-[[4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3aS,6aR)-3-tert-butyl-5-[[4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 66838674 |
| Molecular Formula | C28H31Cl2FN4O4 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | (3aS,6aR)-3-tert-butyl-5-[[4-(3,4-dichloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1OCC1C[C@H]2CN(C(=O)O)C(C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C28H31Cl2FN4O4/c1-28(2,3)25-16-8-14(7-15(16)11-35(25)27(36)37)12-39-22-10-20-17(9-21(22)38-4)26(33-13-32-20)34-19-6-5-18(29)23(30)24(19)31/h5-6,9-10,13-16,25H,7-8,11-12H2,1-4H3,(H,36,37)(H,32,33,34)/t14?,15-,16-,25?/m0/s1 |
| InChIKey | RCPHBZSIRKEMES-AIDJLPERSA-N |
| XLogP | 7.26 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|