C24H25Cl2FN4O4 — CID 167487515
[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl] N-tert-butylcarbamate (PubChem CID 167487515) has the molecular formula C24H25Cl2FN4O4 and a molecular weight of 523.39 g/mol. Its IUPAC name is [3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl] N-tert-butylcarbamate.
| Compound Name | [3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 167487515 |
| Molecular Formula | C24H25Cl2FN4O4 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | [3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl] N-tert-butylcarbamate |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CC(OC(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C24H25Cl2FN4O4/c1-24(2,3)31-23(32)35-13-7-12(8-13)34-19-9-14-17(10-18(19)33-4)28-11-29-22(14)30-16-6-5-15(25)20(26)21(16)27/h5-6,9-13H,7-8H2,1-4H3,(H,31,32)(H,28,29,30) |
| InChIKey | JGHPAUMWGJMWOA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|