C22H21Cl2FN4O2 — CID 167424492
6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 167424492) has the molecular formula C22H21Cl2FN4O2 and a molecular weight of 463.34 g/mol. Its IUPAC name is 6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 167424492 |
| Molecular Formula | C22H21Cl2FN4O2 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 6-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CC2CNCC2C1 |
| InChI | InChI=1S/C22H21Cl2FN4O2/c1-30-18-7-17-14(6-19(18)31-13-4-11-8-26-9-12(11)5-13)22(28-10-27-17)29-16-3-2-15(23)20(24)21(16)25/h2-3,6-7,10-13,26H,4-5,8-9H2,1H3,(H,27,28,29) |
| InChIKey | LNSYIHFTNKCUFI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|