C20H17Cl2F3N4O2 — CID 155669690
N-(3,4-dichloro-2-fluorophenyl)-7-(difluoromethoxy)-6-piperidin-4-yloxyquinazolin-4-amine (PubChem CID 155669690) has the molecular formula C20H17Cl2F3N4O2 and a molecular weight of 473.28 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-7-(difluoromethoxy)-6-piperidin-4-yloxyquinazolin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-7-(difluoromethoxy)-6-piperidin-4-yloxyquinazolin-4-amine |
|---|---|
| PubChem CID | 155669690 |
| Molecular Formula | C20H17Cl2F3N4O2 |
| Molecular Weight | 473.28 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-7-(difluoromethoxy)-6-piperidin-4-yloxyquinazolin-4-amine |
| SMILES | Fc1c(Nc2ncnc3cc(OC(F)F)c(OC4CCNCC4)cc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C20H17Cl2F3N4O2/c21-12-1-2-13(18(23)17(12)22)29-19-11-7-15(30-10-3-5-26-6-4-10)16(31-20(24)25)8-14(11)27-9-28-19/h1-2,7-10,20,26H,3-6H2,(H,27,28,29) |
| InChIKey | FGQRSBHWAJWCFM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.28 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|