C21H20Cl2FN3O2 — CID 155669681
N-(3,4-dichloro-2-fluorophenyl)-7-methoxy-6-piperidin-4-yloxyquinolin-4-amine (PubChem CID 155669681) has the molecular formula C21H20Cl2FN3O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-7-methoxy-6-piperidin-4-yloxyquinolin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-7-methoxy-6-piperidin-4-yloxyquinolin-4-amine |
|---|---|
| PubChem CID | 155669681 |
| Molecular Formula | C21H20Cl2FN3O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-7-methoxy-6-piperidin-4-yloxyquinolin-4-amine |
| SMILES | COc1cc2nccc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CCNCC1 |
| InChI | InChI=1S/C21H20Cl2FN3O2/c1-28-18-11-17-13(10-19(18)29-12-4-7-25-8-5-12)15(6-9-26-17)27-16-3-2-14(22)20(23)21(16)24/h2-3,6,9-12,25H,4-5,7-8H2,1H3,(H,26,27) |
| InChIKey | JGHPIWCTIOAVEM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|