C19H19ClN2O4 — CID 53264749
N-(4-chloro-2,5-dimethoxyphenyl)-6,7-dimethoxyquinolin-4-amine (PubChem CID 53264749) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-6,7-dimethoxyquinolin-4-amine.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-6,7-dimethoxyquinolin-4-amine |
|---|---|
| PubChem CID | 53264749 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-6,7-dimethoxyquinolin-4-amine |
| SMILES | COc1cc(Nc2ccnc3cc(OC)c(OC)cc23)c(OC)cc1Cl |
| InChI | InChI=1S/C19H19ClN2O4/c1-23-16-10-15(17(24-2)8-12(16)20)22-13-5-6-21-14-9-19(26-4)18(25-3)7-11(13)14/h5-10H,1-4H3,(H,21,22) |
| InChIKey | ZHXVYVQZHSPLDW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |