C39H36ClFN2O3Si — CID 54345924
N-[5-[tert-butyl(diphenyl)silyl]oxy-4-chloro-2-fluorophenyl]-6-methoxy-7-phenylmethoxyquinolin-4-amine (PubChem CID 54345924) has the molecular formula C39H36ClFN2O3Si and a molecular weight of 663.27 g/mol. Its IUPAC name is N-[5-[tert-butyl(diphenyl)silyl]oxy-4-chloro-2-fluorophenyl]-6-methoxy-7-phenylmethoxyquinolin-4-amine.
| Compound Name | N-[5-[tert-butyl(diphenyl)silyl]oxy-4-chloro-2-fluorophenyl]-6-methoxy-7-phenylmethoxyquinolin-4-amine |
|---|---|
| PubChem CID | 54345924 |
| Molecular Formula | C39H36ClFN2O3Si |
| Molecular Weight | 663.27 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | N-[5-[tert-butyl(diphenyl)silyl]oxy-4-chloro-2-fluorophenyl]-6-methoxy-7-phenylmethoxyquinolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)c(Cl)cc3F)ccnc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C39H36ClFN2O3Si/c1-39(2,3)47(28-16-10-6-11-17-28,29-18-12-7-13-19-29)46-36-25-35(32(41)23-31(36)40)43-33-20-21-42-34-24-38(37(44-4)22-30(33)34)45-26-27-14-8-5-9-15-27/h5-25H,26H2,1-4H3,(H,42,43) |
| InChIKey | UCHSIPXMHLQIMQ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.27 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|