C25H22FN3O5 — CID 22624931
[4-fluoro-5-[(6-methoxy-7-phenylmethoxyquinazolin-4-yl)amino]-2-methylphenyl] methyl carbonate (PubChem CID 22624931) has the molecular formula C25H22FN3O5 and a molecular weight of 463.47 g/mol. Its IUPAC name is [4-fluoro-5-[(6-methoxy-7-phenylmethoxyquinazolin-4-yl)amino]-2-methylphenyl] methyl carbonate.
| Compound Name | [4-fluoro-5-[(6-methoxy-7-phenylmethoxyquinazolin-4-yl)amino]-2-methylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 22624931 |
| Molecular Formula | C25H22FN3O5 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | [4-fluoro-5-[(6-methoxy-7-phenylmethoxyquinazolin-4-yl)amino]-2-methylphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(Nc2ncnc3cc(OCc4ccccc4)c(OC)cc23)c(F)cc1C |
| InChI | InChI=1S/C25H22FN3O5/c1-15-9-18(26)20(12-21(15)34-25(30)32-3)29-24-17-10-22(31-2)23(11-19(17)27-14-28-24)33-13-16-7-5-4-6-8-16/h4-12,14H,13H2,1-3H3,(H,27,28,29) |
| InChIKey | ZRXPUXNZEDZJRH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|