C24H28FN5O4 — CID 67671472
[4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate (PubChem CID 67671472) has the molecular formula C24H28FN5O4 and a molecular weight of 469.52 g/mol. Its IUPAC name is [4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate.
| Compound Name | [4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 67671472 |
| Molecular Formula | C24H28FN5O4 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | [4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(Nc2ncnc3cc(NCCCN4CCOCC4)ccc23)c(F)cc1C |
| InChI | InChI=1S/C24H28FN5O4/c1-16-12-19(25)21(14-22(16)34-24(31)32-2)29-23-18-5-4-17(13-20(18)27-15-28-23)26-6-3-7-30-8-10-33-11-9-30/h4-5,12-15,26H,3,6-11H2,1-2H3,(H,27,28,29) |
| InChIKey | SDAVJJUOJGRDRH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|