C24H26FN5O5 — CID 21260355
[4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropanoylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate (PubChem CID 21260355) has the molecular formula C24H26FN5O5 and a molecular weight of 483.50 g/mol. Its IUPAC name is [4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropanoylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate.
| Compound Name | [4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropanoylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 21260355 |
| Molecular Formula | C24H26FN5O5 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [4-fluoro-2-methyl-5-[[7-(3-morpholin-4-ylpropanoylamino)quinazolin-4-yl]amino]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(Nc2ncnc3cc(NC(=O)CCN4CCOCC4)ccc23)c(F)cc1C |
| InChI | InChI=1S/C24H26FN5O5/c1-15-11-18(25)20(13-21(15)35-24(32)33-2)29-23-17-4-3-16(12-19(17)26-14-27-23)28-22(31)5-6-30-7-9-34-10-8-30/h3-4,11-14H,5-10H2,1-2H3,(H,28,31)(H,26,27,29) |
| InChIKey | IQQSYBHHIMMTJC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|