C26H30ClFN6O3 — CID 71555230
(E)-3-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide (PubChem CID 71555230) has the molecular formula C26H30ClFN6O3 and a molecular weight of 535.05 g/mol. Its IUPAC name is (E)-3-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide.
| Compound Name | (E)-3-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71555230 |
| Molecular Formula | C26H30ClFN6O3 |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (E)-3-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide |
| SMILES | [2H]C([2H])([2H])N(/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCCN1CCOCC1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C26H30ClFN6O3/c1-33(2)8-6-25(35)32-23-15-19-22(16-24(23)37-11-3-7-34-9-12-36-13-10-34)29-17-30-26(19)31-18-4-5-21(28)20(27)14-18/h4-6,8,14-17H,3,7,9-13H2,1-2H3,(H,32,35)(H,29,30,31)/b8-6+/i1D3,2D3 |
| InChIKey | FLTNDKBTCLIKCA-KRYIJNDISA-N |
| XLogP | 4.28 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|