C30H31FN6O3 — CID 170136595
N-[4-[2-fluoro-5-(5-methyl-2-pyridinyl)anilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide (PubChem CID 170136595) has the molecular formula C30H31FN6O3 and a molecular weight of 542.62 g/mol. Its IUPAC name is N-[4-[2-fluoro-5-(5-methyl-2-pyridinyl)anilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[2-fluoro-5-(5-methyl-2-pyridinyl)anilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170136595 |
| Molecular Formula | C30H31FN6O3 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-[4-[2-fluoro-5-(5-methyl-2-pyridinyl)anilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3cc(-c4ccc(C)cn4)ccc3F)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C30H31FN6O3/c1-3-29(38)35-27-16-22-25(17-28(27)40-12-4-9-37-10-13-39-14-11-37)33-19-34-30(22)36-26-15-21(6-7-23(26)31)24-8-5-20(2)18-32-24/h3,5-8,15-19H,1,4,9-14H2,2H3,(H,35,38)(H,33,34,36) |
| InChIKey | YJRGDPWIYVZCKM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|