C19H28N6O — CID 22547018
4-N-(2,5-dimethylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 22547018) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2,5-dimethylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22547018 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | Cc1ccc(C)c(Nc2ncnc(NCCCN3CCOCC3)c2N)c1 |
| InChI | InChI=1S/C19H28N6O/c1-14-4-5-15(2)16(12-14)24-19-17(20)18(22-13-23-19)21-6-3-7-25-8-10-26-11-9-25/h4-5,12-13H,3,6-11,20H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | TTWLIBSGFVZMCP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|