C16H22BrN7O — CID 19143888
4-N-(5-bromo-2-pyridinyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 19143888) has the molecular formula C16H22BrN7O and a molecular weight of 408.30 g/mol. Its IUPAC name is 4-N-(5-bromo-2-pyridinyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(5-bromo-2-pyridinyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143888 |
| Molecular Formula | C16H22BrN7O |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-N-(5-bromo-2-pyridinyl)-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCN2CCOCC2)ncnc1Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C16H22BrN7O/c17-12-2-3-13(20-10-12)23-16-14(18)15(21-11-22-16)19-4-1-5-24-6-8-25-9-7-24/h2-3,10-11H,1,4-9,18H2,(H2,19,20,21,22,23) |
| InChIKey | FWTGYQWSPKEBAW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|