C9H9BrN6 — CID 19137129
4-N-(5-bromo-2-pyridinyl)pyrimidine-4,5,6-triamine (PubChem CID 19137129) has the molecular formula C9H9BrN6 and a molecular weight of 281.12 g/mol. Its IUPAC name is 4-N-(5-bromo-2-pyridinyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(5-bromo-2-pyridinyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19137129 |
| Molecular Formula | C9H9BrN6 |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 4-N-(5-bromo-2-pyridinyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1ncnc(Nc2ccc(Br)cn2)c1N |
| InChI | InChI=1S/C9H9BrN6/c10-5-1-2-6(13-3-5)16-9-7(11)8(12)14-4-15-9/h1-4H,11H2,(H3,12,13,14,15,16) |
| InChIKey | OJPXLMLOHCEHQQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |