C23H28N6O2 — CID 19143987
6-N-(3-morpholin-4-ylpropyl)-4-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19143987) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 6-N-(3-morpholin-4-ylpropyl)-4-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(3-morpholin-4-ylpropyl)-4-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143987 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 6-N-(3-morpholin-4-ylpropyl)-4-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCN2CCOCC2)ncnc1Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N6O2/c24-21-22(25-11-4-12-29-13-15-30-16-14-29)26-17-27-23(21)28-18-7-9-20(10-8-18)31-19-5-2-1-3-6-19/h1-3,5-10,17H,4,11-16,24H2,(H2,25,26,27,28) |
| InChIKey | HSHMPVBWTJVBEN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|