C25H32N6O — CID 19136362
4-N,4-N-dibenzyl-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine (PubChem CID 19136362) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19136362 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-(3-morpholin-4-ylpropyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCN2CCOCC2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H32N6O/c26-23-24(27-12-7-13-30-14-16-32-17-15-30)28-20-29-25(23)31(18-21-8-3-1-4-9-21)19-22-10-5-2-6-11-22/h1-6,8-11,20H,7,12-19,26H2,(H,27,28,29) |
| InChIKey | BAAJVLFXCUKVMK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|