C20H30N6O2 — CID 19143093
4-N-(4-butoxyphenyl)-6-N-(2-morpholin-4-ylethyl)pyrimidine-4,5,6-triamine (PubChem CID 19143093) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-6-N-(2-morpholin-4-ylethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(4-butoxyphenyl)-6-N-(2-morpholin-4-ylethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143093 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-6-N-(2-morpholin-4-ylethyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(NCCN3CCOCC3)c2N)cc1 |
| InChI | InChI=1S/C20H30N6O2/c1-2-3-12-28-17-6-4-16(5-7-17)25-20-18(21)19(23-15-24-20)22-8-9-26-10-13-27-14-11-26/h4-7,15H,2-3,8-14,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | OAUFKBYPYSPPEN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|