C25H22FN3O4 — CID 21260312
[4-(2-fluoro-4-methyl-5-phenylmethoxyanilino)-6-methoxyquinazolin-7-yl] acetate (PubChem CID 21260312) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is [4-(2-fluoro-4-methyl-5-phenylmethoxyanilino)-6-methoxyquinazolin-7-yl] acetate.
| Compound Name | [4-(2-fluoro-4-methyl-5-phenylmethoxyanilino)-6-methoxyquinazolin-7-yl] acetate |
|---|---|
| PubChem CID | 21260312 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [4-(2-fluoro-4-methyl-5-phenylmethoxyanilino)-6-methoxyquinazolin-7-yl] acetate |
| SMILES | COc1cc2c(Nc3cc(OCc4ccccc4)c(C)cc3F)ncnc2cc1OC(C)=O |
| InChI | InChI=1S/C25H22FN3O4/c1-15-9-19(26)21(12-22(15)32-13-17-7-5-4-6-8-17)29-25-18-10-23(31-3)24(33-16(2)30)11-20(18)27-14-28-25/h4-12,14H,13H2,1-3H3,(H,27,28,29) |
| InChIKey | KGEIWINLRVILOW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|