C19H14F3N3O4 — CID 122446156
[7-acetyloxy-4-[2-(trifluoromethyl)anilino]quinazolin-6-yl] acetate (PubChem CID 122446156) has the molecular formula C19H14F3N3O4 and a molecular weight of 405.33 g/mol. Its IUPAC name is [7-acetyloxy-4-[2-(trifluoromethyl)anilino]quinazolin-6-yl] acetate.
| Compound Name | [7-acetyloxy-4-[2-(trifluoromethyl)anilino]quinazolin-6-yl] acetate |
|---|---|
| PubChem CID | 122446156 |
| Molecular Formula | C19H14F3N3O4 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [7-acetyloxy-4-[2-(trifluoromethyl)anilino]quinazolin-6-yl] acetate |
| SMILES | CC(=O)Oc1cc2ncnc(Nc3ccccc3C(F)(F)F)c2cc1OC(C)=O |
| InChI | InChI=1S/C19H14F3N3O4/c1-10(26)28-16-7-12-15(8-17(16)29-11(2)27)23-9-24-18(12)25-14-6-4-3-5-13(14)19(20,21)22/h3-9H,1-2H3,(H,23,24,25) |
| InChIKey | LKIMTDYKLALHTQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|