C19H14FN3O3 — CID 45140352
[4-(3-ethynyl-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate (PubChem CID 45140352) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is [4-(3-ethynyl-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate.
| Compound Name | [4-(3-ethynyl-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate |
|---|---|
| PubChem CID | 45140352 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [4-(3-ethynyl-4-fluoroanilino)-7-methoxyquinazolin-6-yl] acetate |
| SMILES | C#Cc1cc(Nc2ncnc3cc(OC)c(OC(C)=O)cc23)ccc1F |
| InChI | InChI=1S/C19H14FN3O3/c1-4-12-7-13(5-6-15(12)20)23-19-14-8-18(26-11(2)24)17(25-3)9-16(14)21-10-22-19/h1,5-10H,2-3H3,(H,21,22,23) |
| InChIKey | HWEPGOBNKGSELI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|