C18H14N4O4 — CID 155004316
[4-(1,2-benzoxazol-5-ylamino)-7-methoxyquinazolin-6-yl] acetate (PubChem CID 155004316) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-5-ylamino)-7-methoxyquinazolin-6-yl] acetate.
| Compound Name | [4-(1,2-benzoxazol-5-ylamino)-7-methoxyquinazolin-6-yl] acetate |
|---|---|
| PubChem CID | 155004316 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [4-(1,2-benzoxazol-5-ylamino)-7-methoxyquinazolin-6-yl] acetate |
| SMILES | COc1cc2ncnc(Nc3ccc4oncc4c3)c2cc1OC(C)=O |
| InChI | InChI=1S/C18H14N4O4/c1-10(23)25-17-6-13-14(7-16(17)24-2)19-9-20-18(13)22-12-3-4-15-11(5-12)8-21-26-15/h3-9H,1-2H3,(H,19,20,22) |
| InChIKey | RQCRKSACWPBCOE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|