C24H25N3O5 — CID 25026628
7-[4-(3-ethynyl-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxyheptanoic acid (PubChem CID 25026628) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 7-[4-(3-ethynyl-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxyheptanoic acid.
| Compound Name | 7-[4-(3-ethynyl-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 25026628 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 7-[4-(3-ethynyl-4-hydroxyanilino)-7-methoxyquinazolin-6-yl]oxyheptanoic acid |
| SMILES | C#Cc1cc(Nc2ncnc3cc(OC)c(OCCCCCCC(=O)O)cc23)ccc1O |
| InChI | InChI=1S/C24H25N3O5/c1-3-16-12-17(9-10-20(16)28)27-24-18-13-22(21(31-2)14-19(18)25-15-26-24)32-11-7-5-4-6-8-23(29)30/h1,9-10,12-15,28H,4-8,11H2,2H3,(H,29,30)(H,25,26,27) |
| InChIKey | BLIAMRZWXOKGLP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|