C25H31N3O5 — CID 66755705
7-[7-methoxy-4-[1-(4-methoxyphenyl)ethylamino]quinazolin-6-yl]oxyheptanoic acid (PubChem CID 66755705) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 7-[7-methoxy-4-[1-(4-methoxyphenyl)ethylamino]quinazolin-6-yl]oxyheptanoic acid.
| Compound Name | 7-[7-methoxy-4-[1-(4-methoxyphenyl)ethylamino]quinazolin-6-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 66755705 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 7-[7-methoxy-4-[1-(4-methoxyphenyl)ethylamino]quinazolin-6-yl]oxyheptanoic acid |
| SMILES | COc1ccc(C(C)Nc2ncnc3cc(OC)c(OCCCCCCC(=O)O)cc23)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-17(18-9-11-19(31-2)12-10-18)28-25-20-14-23(22(32-3)15-21(20)26-16-27-25)33-13-7-5-4-6-8-24(29)30/h9-12,14-17H,4-8,13H2,1-3H3,(H,29,30)(H,26,27,28) |
| InChIKey | XRYKLGBRQUMAJM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|