2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid

C14H15N3O6 — CID 21002993

IUPAC2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid
SMILESCOc1cc2ncnc(NC(CC(=O)O)C(=O)O)c2cc1OC
InChIInChI=1S/C14H15N3O6/c1-22-10-3-7-8(4-11(10)23-2)15-6-16-13(7)17-9(14(20)21)5-12(18)19/h3-4,6,9H,5H2,1-2H3,(H,18,19)(H,20,21)(H,15,16,17)
InChIKeyHYJLESICIUTCOX-UHFFFAOYSA-N
MW321.29 g/mol
LogP0.99
Rot. Bonds7

About 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid

2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid (PubChem CID 21002993) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid.

Molecular Properties

Compound Name2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid
PubChem CID21002993
Molecular FormulaC14H15N3O6
Molecular Weight321.29 g/mol
Exact Mass321.10
IUPAC Name2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid
SMILESCOc1cc2ncnc(NC(CC(=O)O)C(=O)O)c2cc1OC
InChIInChI=1S/C14H15N3O6/c1-22-10-3-7-8(4-11(10)23-2)15-6-16-13(7)17-9(14(20)21)5-12(18)19/h3-4,6,9H,5H2,1-2H3,(H,18,19)(H,20,21)(H,15,16,17)
InChIKeyHYJLESICIUTCOX-UHFFFAOYSA-N
XLogP0.99
TPSA130.87 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.29
LogP ≤ 50.99
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Analyze 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid?
The IUPAC name of 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid (CID 21002993) is 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid.
What is the SMILES notation for 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid?
The canonical SMILES for 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid is COc1cc2ncnc(NC(CC(=O)O)C(=O)O)c2cc1OC.
What is the InChIKey of 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid?
The InChIKey is HYJLESICIUTCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O6/c1-22-10-3-7-8(4-11(10)23-2)15-6-16-13(7)17-9(14(20)21)5-12(18)19/h3-4,6,9H,5H2,1-2H3,(H,18,19)(H,20,21)(H,15,16,17).
What are the key properties of 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid?
2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid has a molecular weight of 321.29 g/mol, XLogP of 0.99, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid is sourced from PubChem (CID 21002993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).