C14H15N3O6 — CID 21002993
2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid (PubChem CID 21002993) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid.
| Compound Name | 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid |
|---|---|
| PubChem CID | 21002993 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[(6,7-dimethoxyquinazolin-4-yl)amino]butanedioic acid |
| SMILES | COc1cc2ncnc(NC(CC(=O)O)C(=O)O)c2cc1OC |
| InChI | InChI=1S/C14H15N3O6/c1-22-10-3-7-8(4-11(10)23-2)15-6-16-13(7)17-9(14(20)21)5-12(18)19/h3-4,6,9H,5H2,1-2H3,(H,18,19)(H,20,21)(H,15,16,17) |
| InChIKey | HYJLESICIUTCOX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |