C13H11N3O6 — CID 1414229
(2R)-2-[(7-carboxyquinazolin-4-yl)amino]butanedioic acid (PubChem CID 1414229) has the molecular formula C13H11N3O6 and a molecular weight of 305.25 g/mol. Its IUPAC name is (2R)-2-[(7-carboxyquinazolin-4-yl)amino]butanedioic acid.
| Compound Name | (2R)-2-[(7-carboxyquinazolin-4-yl)amino]butanedioic acid |
|---|---|
| PubChem CID | 1414229 |
| Molecular Formula | C13H11N3O6 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2R)-2-[(7-carboxyquinazolin-4-yl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](Nc1ncnc2cc(C(=O)O)ccc12)C(=O)O |
| InChI | InChI=1S/C13H11N3O6/c17-10(18)4-9(13(21)22)16-11-7-2-1-6(12(19)20)3-8(7)14-5-15-11/h1-3,5,9H,4H2,(H,17,18)(H,19,20)(H,21,22)(H,14,15,16)/t9-/m1/s1 |
| InChIKey | SUWRKSCBVYPNDX-SECBINFHSA-N |
| XLogP | 0.67 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |