C14H17N3O3S — CID 106161960
4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]quinazoline-7-carboxylic acid (PubChem CID 106161960) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]quinazoline-7-carboxylic acid.
| Compound Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]quinazoline-7-carboxylic acid |
|---|---|
| PubChem CID | 106161960 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]quinazoline-7-carboxylic acid |
| SMILES | CSC(CO)C(C)Nc1ncnc2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C14H17N3O3S/c1-8(12(6-18)21-2)17-13-10-4-3-9(14(19)20)5-11(10)15-7-16-13/h3-5,7-8,12,18H,6H2,1-2H3,(H,19,20)(H,15,16,17) |
| InChIKey | NVNKTNBPDBBQIJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |