C15H18N2O3S — CID 106161974
1-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]isoquinoline-3-carboxylic acid (PubChem CID 106161974) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]isoquinoline-3-carboxylic acid.
| Compound Name | 1-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 106161974 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]isoquinoline-3-carboxylic acid |
| SMILES | CSC(CO)C(C)Nc1nc(C(=O)O)cc2ccccc12 |
| InChI | InChI=1S/C15H18N2O3S/c1-9(13(8-18)21-2)16-14-11-6-4-3-5-10(11)7-12(17-14)15(19)20/h3-7,9,13,18H,8H2,1-2H3,(H,16,17)(H,19,20) |
| InChIKey | CJLYQGRZAXMMBP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |