C18H21N5O4S — CID 150898043
6,7-dimethoxy-4-[[(1R)-1-[4-(sulfamoylamino)phenyl]ethyl]amino]quinazoline (PubChem CID 150898043) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[[(1R)-1-[4-(sulfamoylamino)phenyl]ethyl]amino]quinazoline.
| Compound Name | 6,7-dimethoxy-4-[[(1R)-1-[4-(sulfamoylamino)phenyl]ethyl]amino]quinazoline |
|---|---|
| PubChem CID | 150898043 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 6,7-dimethoxy-4-[[(1R)-1-[4-(sulfamoylamino)phenyl]ethyl]amino]quinazoline |
| SMILES | COc1cc2ncnc(N[C@H](C)c3ccc(NS(N)(=O)=O)cc3)c2cc1OC |
| InChI | InChI=1S/C18H21N5O4S/c1-11(12-4-6-13(7-5-12)23-28(19,24)25)22-18-14-8-16(26-2)17(27-3)9-15(14)20-10-21-18/h4-11,23H,1-3H3,(H2,19,24,25)(H,20,21,22)/t11-/m1/s1 |
| InChIKey | KZKMYJHDBLCQLR-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |