C16H15BrN4O — CID 146148083
7-bromo-6-methoxy-N-[(1S)-1-pyridin-3-ylethyl]quinazolin-4-amine (PubChem CID 146148083) has the molecular formula C16H15BrN4O and a molecular weight of 359.23 g/mol. Its IUPAC name is 7-bromo-6-methoxy-N-[(1S)-1-pyridin-3-ylethyl]quinazolin-4-amine.
| Compound Name | 7-bromo-6-methoxy-N-[(1S)-1-pyridin-3-ylethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146148083 |
| Molecular Formula | C16H15BrN4O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 7-bromo-6-methoxy-N-[(1S)-1-pyridin-3-ylethyl]quinazolin-4-amine |
| SMILES | COc1cc2c(N[C@@H](C)c3cccnc3)ncnc2cc1Br |
| InChI | InChI=1S/C16H15BrN4O/c1-10(11-4-3-5-18-8-11)21-16-12-6-15(22-2)13(17)7-14(12)19-9-20-16/h3-10H,1-2H3,(H,19,20,21)/t10-/m0/s1 |
| InChIKey | KCVWEUPFSQPFOT-JTQLQIEISA-N |
| XLogP | 3.97 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |