C11H12ClN5 — CID 114049758
5-chloro-4-N-(1-pyridin-3-ylethyl)pyrimidine-4,6-diamine (PubChem CID 114049758) has the molecular formula C11H12ClN5 and a molecular weight of 249.71 g/mol. Its IUPAC name is 5-chloro-4-N-(1-pyridin-3-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(1-pyridin-3-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114049758 |
| Molecular Formula | C11H12ClN5 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 5-chloro-4-N-(1-pyridin-3-ylethyl)pyrimidine-4,6-diamine |
| SMILES | CC(Nc1ncnc(N)c1Cl)c1cccnc1 |
| InChI | InChI=1S/C11H12ClN5/c1-7(8-3-2-4-14-5-8)17-11-9(12)10(13)15-6-16-11/h2-7H,1H3,(H3,13,15,16,17) |
| InChIKey | XGQTWUPIGBECBI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |