C15H19ClN6 — CID 129479354
5-chloro-6-[4-[(1R)-1-pyridin-3-ylethyl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 129479354) has the molecular formula C15H19ClN6 and a molecular weight of 318.81 g/mol. Its IUPAC name is 5-chloro-6-[4-[(1R)-1-pyridin-3-ylethyl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 5-chloro-6-[4-[(1R)-1-pyridin-3-ylethyl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129479354 |
| Molecular Formula | C15H19ClN6 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 5-chloro-6-[4-[(1R)-1-pyridin-3-ylethyl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | C[C@H](c1cccnc1)N1CCN(c2ncnc(N)c2Cl)CC1 |
| InChI | InChI=1S/C15H19ClN6/c1-11(12-3-2-4-18-9-12)21-5-7-22(8-6-21)15-13(16)14(17)19-10-20-15/h2-4,9-11H,5-8H2,1H3,(H2,17,19,20)/t11-/m1/s1 |
| InChIKey | HNYJZRHHAJSCRW-LLVKDONJSA-N |
| XLogP | 1.99 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |