C19H26N4 — CID 110452626
N,N-dimethyl-3-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]aniline (PubChem CID 110452626) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]aniline.
| Compound Name | N,N-dimethyl-3-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 110452626 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N,N-dimethyl-3-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]aniline |
| SMILES | CC(c1cccnc1)N1CCN(c2cccc(N(C)C)c2)CC1 |
| InChI | InChI=1S/C19H26N4/c1-16(17-6-5-9-20-15-17)22-10-12-23(13-11-22)19-8-4-7-18(14-19)21(2)3/h4-9,14-16H,10-13H2,1-3H3 |
| InChIKey | XIGACRHDYGLSFA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |