C18H21F3N4O2S — CID 133339613
4-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133339613) has the molecular formula C18H21F3N4O2S and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133339613 |
| Molecular Formula | C18H21F3N4O2S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-[4-(1-pyridin-3-ylethyl)piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(c1cccnc1)N1CCN(c2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H21F3N4O2S/c1-13(14-3-2-6-23-12-14)24-7-9-25(10-8-24)15-4-5-17(28(22,26)27)16(11-15)18(19,20)21/h2-6,11-13H,7-10H2,1H3,(H2,22,26,27) |
| InChIKey | RGPDLCOMLLLDSH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |