C20H22F3N3O3S — CID 133343259
4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133343259) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133343259 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 4-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccccc1CC(=O)N1CCN(c2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H22F3N3O3S/c1-14-4-2-3-5-15(14)12-19(27)26-10-8-25(9-11-26)16-6-7-18(30(24,28)29)17(13-16)20(21,22)23/h2-7,13H,8-12H2,1H3,(H2,24,28,29) |
| InChIKey | ZOFWOTREIBMRNQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |