C21H22F3NO — CID 159142820
2-(2-methylphenyl)-1-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone (PubChem CID 159142820) has the molecular formula C21H22F3NO and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(2-methylphenyl)-1-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 159142820 |
| Molecular Formula | C21H22F3NO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-(2-methylphenyl)-1-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethanone |
| SMILES | Cc1ccccc1CC(=O)N1CCC(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H22F3NO/c1-15-6-2-3-7-17(15)14-20(26)25-12-10-16(11-13-25)18-8-4-5-9-19(18)21(22,23)24/h2-9,16H,10-14H2,1H3 |
| InChIKey | WUMPZTRDZUZPAC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |