C22H22F3NO3 — CID 159388662
methyl 2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]benzoate (PubChem CID 159388662) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is methyl 2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]benzoate.
| Compound Name | methyl 2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 159388662 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 2-[2-oxo-2-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CC(=O)N1CCC(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H22F3NO3/c1-29-21(28)18-8-3-2-6-16(18)14-20(27)26-12-10-15(11-13-26)17-7-4-5-9-19(17)22(23,24)25/h2-9,15H,10-14H2,1H3 |
| InChIKey | WHVJJMYAQUJHQO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |