C23H23F3N2O3 — CID 118674807
methyl 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]benzoate (PubChem CID 118674807) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is methyl 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 118674807 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C23H23F3N2O3/c1-31-21(29)18-7-3-5-9-20(18)27-22(30)28-12-15-10-14(11-16(15)13-28)17-6-2-4-8-19(17)23(24,25)26/h2-9,14-16H,10-13H2,1H3,(H,27,30)/t14?,15-,16+ |
| InChIKey | PNMXEROGUMTMOJ-MQVJKMGUSA-N |
| XLogP | 5.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |